ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28046-05-1 4-chloor-2-(prop-2-en-1-yloxy)-N-[2-(pyrrolidine-1-yl)ethyl]benzamide |
|
| Naam product | 4-chloor-2-(prop-2-en-1-yloxy)-N-[2-(pyrrolidine-1-yl)ethyl]benzamide |
| Engelse naam | 4-chloro-2-(prop-2-en-1-yloxy)-N-[2-(pyrrolidin-1-yl)ethyl]benzamide; |
| MF | C16H21ClN2O2 |
| Molecuulgewicht | 308.8031 |
| InChI | InChI=1/C16H21ClN2O2/c1-2-11-21-15-12-13(17)5-6-14(15)16(20)18-7-10-19-8-3-4-9-19/h2,5-6,12H,1,3-4,7-11H2,(H,18,20) |
| CAS-nummer | 28046-05-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.16g/cm3 |
| Kookpunt | 457.7°C at 760 mmHg |
| Brekingsindex | 1.552 |
| Vlampunt | 230.6°C |
| Dampdruk | 1.46E-08mmHg at 25°C |
| MSDS | |