ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2849-93-6 1H-benzimidazole-2-carboxylic acid |
|
Naam product | 1H-benzimidazole-2-carboxylic acid |
Engelse naam | 1H-benzimidazole-2-carboxylic acid;2-Benzimidazolecarboxylic acid |
MF | C8H6N2O2 |
Molecuulgewicht | 162.1454 |
InChI | InChI=1/C8H6N2O2/c11-8(12)7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)(H,11,12) |
CAS-nummer | 2849-93-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.507g/cm3 |
Smeltpunt | 169℃ |
Kookpunt | 443.991°C at 760 mmHg |
Brekingsindex | 1.743 |
Vlampunt | 222.318°C |
Dampdruk | 0mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |