ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
304445-49-6 1-(4-Bromo-3-fluorophenyl)ethanone |
|
| Naam product | 1-(4-Bromo-3-fluorophenyl)ethanone |
| Engelse naam | 1-(4-Bromo-3-fluorophenyl)ethanone;3-Fluoro-4-bromo-acetophenone;4-Bromo-3-fluoro-acetophenone;ethanone, 1-(4-bromo-3-fluorophenyl)- |
| MF | C8H6BrFO |
| Molecuulgewicht | 217.035 |
| InChI | InChI=1/C8H6BrFO/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3 |
| CAS-nummer | 304445-49-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.535g/cm3 |
| Kookpunt | 263.3°C at 760 mmHg |
| Brekingsindex | 1.534 |
| Vlampunt | 113°C |
| Dampdruk | 0.0104mmHg at 25°C |
| MSDS | |