ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30877-81-7 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
|
| Naam product | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
| Engelse naam | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone;1-(3-amino-4-piperidinophenyl)ethan-1-one |
| MF | C13H18N2O |
| Molecuulgewicht | 218.2948 |
| InChI | InChI=1/C13H18N2O/c1-10(16)11-5-6-13(12(14)9-11)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8,14H2,1H3 |
| CAS-nummer | 30877-81-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.116g/cm3 |
| Kookpunt | 425.5°C at 760 mmHg |
| Brekingsindex | 1.582 |
| Vlampunt | 211.1°C |
| Dampdruk | 1.9E-07mmHg at 25°C |
| MSDS | |