ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
339-59-3 4-(Trifluoromethyl)benzhydrazide | 
    |
| Naam product | 4-(Trifluoromethyl)benzhydrazide | 
| Engelse naam | 4-(Trifluoromethyl)benzhydrazide;4-(Trifluoromethyl)benzohydrazide;TIMTEC-BB SBB001890;4-(TRIFLUOROMETHYL)BENZOIC ACID HYDRAZIDE;4-(TRIFLUOROMETHYL)BENZENE-1-CARBOHYDRAZIDE;ALPHA,ALPHA,ALPHA-TRIFLUORO-P-TOLUIC ACID HYDRAZIDE;AKOS BBS-00001991;BUTTPARK 30\01-48;ethyl N-(3-chloro-4-fluorophenyl)-N-(phenylcarbonyl)alaninate;4-(Trifluoromethyl)-benzoic acid hydrazide | 
| MF | C18H17ClFNO3 | 
| Molecuulgewicht | 349.7839 | 
| InChI | InChI=1/C18H17ClFNO3/c1-3-24-18(23)12(2)21(14-9-10-16(20)15(19)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 | 
| CAS-nummer | 339-59-3 | 
| Moleculaire Structuur | ![]()  | 
    
| Dichtheid | 1.281g/cm3 | 
| Smeltpunt | 115-119℃ | 
| Kookpunt | 470.6°C at 760 mmHg | 
| Brekingsindex | 1.578 | 
| Vlampunt | 238.4°C | 
| Dampdruk | 5.01E-09mmHg at 25°C | 
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |