ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3440-24-2 3',4',7,8-tetrahydroxyflavon |
|
Naam product | 3',4',7,8-tetrahydroxyflavon |
Synoniemen | 2-(3,4-dihydroxyfenyl)-7,8-dihydroxy-4H-chromen-4-on; |
Engelse naam | 3',4',7,8-Tetrahydroxyflavone;2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one |
MF | C15H10O6 |
Molecuulgewicht | 286.2363 |
InChI | InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H |
CAS-nummer | 3440-24-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.654g/cm3 |
Kookpunt | 618.9°C at 760 mmHg |
Brekingsindex | 1.767 |
Vlampunt | 240.6°C |
Dampdruk | 6.57E-16mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |