ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3486-35-9 Zinc carbonate |
|
Naam product | Zinc carbonate |
Engelse naam | Zinc carbonate;C.I. 77950;Carbonic acid, zinc salt (1:1);zinc(+2) cation carbonate;[Carbonato(2-)-kappa~2~O,O']zinc;222-477-6;Zinc carbonate;zinc, [carbonato(2-)-kappaO,kappaO']- |
MF | ZnCO3 |
Molecuulgewicht | 125.419 |
InChI | InChI=1/CH2O3.Zn/c2-1(3)4;/h(H2,2,3,4);/p-2 |
CAS-nummer | 3486-35-9;10476-83-2 |
EINECS | 222-477-6 |
Moleculaire Structuur | ![]() |
Kookpunt | 333.6°C at 760 mmHg |
Vlampunt | 169.8°C |
Dampdruk | 2.58E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |