ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-99-2 ethyl-4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrool-2-carboxylaat |
|
Naam product | ethyl-4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrool-2-carboxylaat |
Synoniemen | ethyl-4-(hydroxymethyl)-3,5-dimethyl-1H-pyrrool-2-carboxylaat; |
Engelse naam | ethyl 4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrole-2-carboxylate;ethyl 4-(hydroxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
MF | C10H15NO3 |
Molecuulgewicht | 197.231 |
InChI | InChI=1/C10H15NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h11-12H,4-5H2,1-3H3 |
CAS-nummer | 368869-99-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.17g/cm3 |
Smeltpunt | 231℃ |
Kookpunt | 360.6°C at 760 mmHg |
Brekingsindex | 1.543 |
Vlampunt | 171.9°C |
Dampdruk | 7.89E-06mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |