ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37852-60-1 2,2-dichloor-N-(3-fenyl-1,2-oxazol-5-yl)acetamide |
|
| Naam product | 2,2-dichloor-N-(3-fenyl-1,2-oxazol-5-yl)acetamide |
| Engelse naam | 2,2-dichloro-N-(3-phenyl-1,2-oxazol-5-yl)acetamide; |
| MF | C11H8Cl2N2O2 |
| Molecuulgewicht | 271.0994 |
| InChI | InChI=1/C11H8Cl2N2O2/c12-10(13)11(16)14-9-6-8(15-17-9)7-4-2-1-3-5-7/h1-6,10H,(H,14,16) |
| CAS-nummer | 37852-60-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.45g/cm3 |
| Kookpunt | 491.1°C at 760 mmHg |
| Brekingsindex | 1.614 |
| Vlampunt | 250.8°C |
| Dampdruk | 8.6E-10mmHg at 25°C |
| MSDS | |