ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39084-87-2 2,2-dichloro-N-(2-ethylphenyl)acetamide |
|
| Naam product | 2,2-dichloro-N-(2-ethylphenyl)acetamide |
| Engelse naam | 2,2-dichloro-N-(2-ethylphenyl)acetamide; |
| MF | C10H11Cl2NO |
| Molecuulgewicht | 232.1064 |
| InChI | InChI=1/C10H11Cl2NO/c1-2-7-5-3-4-6-8(7)13-10(14)9(11)12/h3-6,9H,2H2,1H3,(H,13,14) |
| CAS-nummer | 39084-87-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.3g/cm3 |
| Kookpunt | 359.5°C at 760 mmHg |
| Brekingsindex | 1.583 |
| Vlampunt | 171.2°C |
| Dampdruk | 2.37E-05mmHg at 25°C |
| MSDS | |