ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39232-91-2 3-Methoxyphenylhydrazine hydrochloride |
|
| Naam product | 3-Methoxyphenylhydrazine hydrochloride |
| Engelse naam | 3-Methoxyphenylhydrazine hydrochloride;3-Methoxyphenylhydrazine HCl;(3-methoxyphenyl)hydrazine;m-Methoxyphenylhydrazine hydrochloride;(3-Methoxy-phenyl)-hydrazine HCl |
| MF | C7H11ClN2O |
| Molecuulgewicht | 174.628 |
| InChI | InChI=1/C7H10N2O.ClH/c1-10-7-4-2-3-6(5-7)9-8;/h2-5,9H,8H2,1H3;1H |
| CAS-nummer | 39232-91-2 |
| EINECS | 254-368-4 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 275.3°C at 760 mmHg |
| Vlampunt | 120.3°C |
| Dampdruk | 0.00515mmHg at 25°C |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |