ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-61-9 1H-Pyrazole-3-carboxylicacid, 5-methyl- |
|
| Naam product | 1H-Pyrazole-3-carboxylicacid, 5-methyl- |
| Engelse naam | 1H-Pyrazole-3-carboxylicacid, 5-methyl-;3-methyl-1H-pyrazole-5-carboxylic acid;5-Methyl-1H-pyrazole-3-carboxylic acid;5-methylpyrazole-3-carboxylic acid;5-methyl-1h-pyrazole-3-carboxylic acid; |
| MF | C5H6N2O2 |
| Molecuulgewicht | 126.11 |
| InChI | InChI=1/C5H6N2O2/c1-3-2-4(5(8)9)7-6-3/h2H,1H3,(H,6,7)(H,8,9) |
| CAS-nummer | 402-61-9;696-22-0 |
| EINECS | 206-953-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.404 g/cm3 |
| Kookpunt | 388.8 °C at 760 mmHg |
| Brekingsindex | 1.595 |
| Vlampunt | 188.9 °C |
| Dampdruk | 9.69E-07mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |