ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40220-08-4 tris(2-(acryloyloxy)ethyl) isocyanurate |
|
| Naam product | tris(2-(acryloyloxy)ethyl) isocyanurate |
| Engelse naam | tris(2-(acryloyloxy)ethyl) isocyanurate;Isocyanuric Acid Tris(2-Acryloyloxyethyl) Ester |
| MF | C18H21N3O9 |
| Molecuulgewicht | 423.374 |
| InChI | InChI=1/C18H21N3O9/c1-4-13(22)28-10-7-19-16(25)20(8-11-29-14(23)5-2)18(27)21(17(19)26)9-12-30-15(24)6-3/h4-6H,1-3,7-12H2 |
| CAS-nummer | 40220-08-4 |
| EINECS | 254-843-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.298g/cm3 |
| Kookpunt | 568.3°C at 760 mmHg |
| Brekingsindex | 1.519 |
| Vlampunt | 297.5°C |
| Dampdruk | 6.27E-13mmHg at 25°C |
| MSDS | |