ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41306-29-0 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolaan-5-yl]azijnzuur |
|
| Naam product | 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolaan-5-yl]azijnzuur |
| Synoniemen | [(2Z)-3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidine-5-yl]azijnzuur; |
| Engelse naam | 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid;[(2Z)-3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| MF | C7H10N2O3S |
| Molecuulgewicht | 202.2309 |
| InChI | InChI=1/C7H10N2O3S/c1-8-7-9(2)6(12)4(13-7)3-5(10)11/h4H,3H2,1-2H3,(H,10,11)/b8-7- |
| CAS-nummer | 41306-29-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.47g/cm3 |
| Smeltpunt | 158℃ |
| Kookpunt | 374.5°C at 760 mmHg |
| Brekingsindex | 1.639 |
| Vlampunt | 180.3°C |
| Dampdruk | 1.22E-06mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |