ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43040-50-2 6-(4-methylpiperazine-1-yl)[1]benzothiepino[2,3-b]pyridine di[(2Z)-maar-2-enedioaat] |
|
| Naam product | 6-(4-methylpiperazine-1-yl)[1]benzothiepino[2,3-b]pyridine di[(2Z)-maar-2-enedioaat] |
| Engelse naam | 6-(4-methylpiperazin-1-yl)[1]benzothiepino[2,3-b]pyridine di[(2Z)-but-2-enedioate]; |
| MF | C26H27N3O8S |
| Molecuulgewicht | 541.5729 |
| InChI | InChI=1/C18H19N3S.2C4H4O4/c1-20-9-11-21(12-10-20)16-13-14-5-4-8-19-18(14)22-17-7-3-2-6-15(16)17;2*5-3(6)1-2-4(7)8/h2-8,13H,9-12H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| CAS-nummer | 43040-50-2 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 489.1°C at 760 mmHg |
| Vlampunt | 249.6°C |
| Dampdruk | 1.02E-09mmHg at 25°C |
| MSDS | |