ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43043-76-1 spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-on, 3',6'-dihydroxy-, monoammoniumzout |
|
| Naam product | spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-on, 3',6'-dihydroxy-, monoammoniumzout |
| Engelse naam | spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, monoammonium salt; |
| MF | C20H16NO5 |
| Molecuulgewicht | 350.3442 |
| InChI | InChI=1/C20H12O5.H3N/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;/h1-10,21-22H;1H3/p+1 |
| CAS-nummer | 43043-76-1 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 657.5°C at 760 mmHg |
| Vlampunt | 351.4°C |
| Dampdruk | 6.87E-18mmHg at 25°C |
| MSDS | |