ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43100-50-1 2,5-dichloor-3-fenylcyclohexa-2,5-dieen-1,4-dion |
|
| Naam product | 2,5-dichloor-3-fenylcyclohexa-2,5-dieen-1,4-dion |
| Engelse naam | 2,5-dichloro-3-phenylcyclohexa-2,5-diene-1,4-dione; |
| MF | C12H6Cl2O2 |
| Molecuulgewicht | 253.0808 |
| InChI | InChI=1/C12H6Cl2O2/c13-8-6-9(15)11(14)10(12(8)16)7-4-2-1-3-5-7/h1-6H |
| CAS-nummer | 43100-50-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.46g/cm3 |
| Kookpunt | 378°C at 760 mmHg |
| Brekingsindex | 1.628 |
| Vlampunt | 159.8°C |
| Dampdruk | 6.47E-06mmHg at 25°C |
| MSDS | |