ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446831-27-2 2-piperazine-1-ylbenzoëzuur |
|
| Naam product | 2-piperazine-1-ylbenzoëzuur |
| Synoniemen | 2-(Piperazine-1-yl)benzoëzuur; Benzoëzuur, 2-(1-piperazinyl)-; |
| Engelse naam | 2-piperazin-1-ylbenzoic acid;2-(Piperazin-1-yl)benzoic acid;Benzoic acid, 2-(1-piperazinyl)- |
| MF | C11H14N2O2 |
| Molecuulgewicht | 206.2411 |
| InChI | InChI=1/C11H14N2O2/c14-11(15)9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2,(H,14,15) |
| CAS-nummer | 446831-27-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.211g/cm3 |
| Kookpunt | 399.2°C at 760 mmHg |
| Brekingsindex | 1.58 |
| Vlampunt | 195.2°C |
| Dampdruk | 4.33E-07mmHg at 25°C |
| MSDS | |