ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
| Naam product | 1,2-Dihydronaphthalene |
| Engelse naam | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
| MF | C10H10 |
| Molecuulgewicht | 130.1864 |
| InChI | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| CAS-nummer | 447-53-0 |
| EINECS | 207-183-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.004g/cm3 |
| Smeltpunt | -8℃ |
| Kookpunt | 204.9°C at 760 mmHg |
| Brekingsindex | 1.572 |
| Vlampunt | 70.4°C |
| Dampdruk | 0.367mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |