ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
461-98-3 4-Amino-2,6-dimethylpyrimidine |
|
Naam product | 4-Amino-2,6-dimethylpyrimidine |
Engelse naam | 4-Amino-2,6-dimethylpyrimidine;Kyanmethin;2,6-dimethylpyrimidin-4-ylamine;2,6-dimethylpyrimidin-4-amine |
MF | C6H9N3 |
Molecuulgewicht | 123.1558 |
InChI | InChI=1/C6H9N3/c1-4-3-6(7)9-5(2)8-4/h3H,1-2H3,(H2,7,8,9) |
CAS-nummer | 461-98-3 |
EINECS | 207-320-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.112g/cm3 |
Smeltpunt | 182-185℃ |
Kookpunt | 238.7°C at 760 mmHg |
Brekingsindex | 1.569 |
Vlampunt | 121.3°C |
Dampdruk | 0.0417mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |