ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4706-81-4 2-Tetradecanol |
|
Naam product | 2-Tetradecanol |
Engelse naam | 2-Tetradecanol; |
MF | C14H30O |
Molecuulgewicht | 214.3874 |
InChI | InChI=1/C14H30O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h14-15H,3-13H2,1-2H3 |
CAS-nummer | 4706-81-4 |
EINECS | 225-192-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.832g/cm3 |
Smeltpunt | 32-37℃ |
Kookpunt | 284°C at 760 mmHg |
Brekingsindex | 1.443 |
Vlampunt | 106°C |
Dampdruk | 0.000354mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |