Chemindex > 497-03-0
NL ▼
497-03-0 2-methyl-2-butenal |
|
| Naam product | 2-methyl-2-butenal |
| Engelse naam | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
| MF | C5H8O |
| Molecuulgewicht | 84.11 |
| InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
| CAS-nummer | 497-03-0 |
| EINECS | 207-833-0 |
| Moleculaire Structuur |  |
| Dichtheid | 0.871 |
| Kookpunt | 115-118℃ (752 torr) |
| Brekingsindex | 1.447 |
| Vlampunt | 18℃ |
| Gevaarsymbolen |  F##Highly flammable||Xi##Irritant:; |
| Risico-codes | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 