ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-18-3 Triethylenemelamine |
|
| Naam product | Triethylenemelamine |
| Engelse naam | Triethylenemelamine;Tretamine;2,4,6-tri(aziridin-1-yl)-1,3,5-triazine;2,4,6-Tris(1-aziridinyl)-s-triazine;TEM;2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| MF | C9H12N6 |
| Molecuulgewicht | 204.2318 |
| InChI | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| CAS-nummer | 51-18-3 |
| EINECS | 200-083-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.617g/cm3 |
| Smeltpunt | 160℃ |
| Kookpunt | 430.2°C at 760 mmHg |
| Brekingsindex | 1.789 |
| Vlampunt | 214°C |
| Dampdruk | 1.32E-07mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R28##Very toxic if swallowed.||R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |