ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53499-69-7 N-{4-[(E)-(4-aminophenyl)diazenyl]phenyl}-N-methylacetamide |
|
| Naam product | N-{4-[(E)-(4-aminophenyl)diazenyl]phenyl}-N-methylacetamide |
| Engelse naam | N-{4-[(E)-(4-aminophenyl)diazenyl]phenyl}-N-methylacetamide; |
| MF | C15H16N4O |
| Molecuulgewicht | 268.3137 |
| InChI | InChI=1/C15H16N4O/c1-11(20)19(2)15-9-7-14(8-10-15)18-17-13-5-3-12(16)4-6-13/h3-10H,16H2,1-2H3/b18-17+ |
| CAS-nummer | 53499-69-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.16g/cm3 |
| Kookpunt | 475.3°C at 760 mmHg |
| Brekingsindex | 1.604 |
| Vlampunt | 241.2°C |
| Dampdruk | 3.37E-09mmHg at 25°C |
| MSDS | |