ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5360-38-3 4-[3-(naftaleen-2-yloxy)propyl]morfoline |
|
| Naam product | 4-[3-(naftaleen-2-yloxy)propyl]morfoline |
| Synoniemen | ; |
| Engelse naam | 4-[3-(naphthalen-2-yloxy)propyl]morpholine; |
| MF | C17H21NO2 |
| Molecuulgewicht | 271.3541 |
| InChI | InChI=1/C17H21NO2/c1-2-5-16-14-17(7-6-15(16)4-1)20-11-3-8-18-9-12-19-13-10-18/h1-2,4-7,14H,3,8-13H2 |
| CAS-nummer | 5360-38-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.106g/cm3 |
| Kookpunt | 438.2°C at 760 mmHg |
| Brekingsindex | 1.58 |
| Vlampunt | 163.9°C |
| Dampdruk | 7.03E-08mmHg at 25°C |
| MSDS | |