ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5437-89-8 4-cyclohexyl-2-(2-cyclohexylethyl)-N-ethylbutanamide |
|
| Naam product | 4-cyclohexyl-2-(2-cyclohexylethyl)-N-ethylbutanamide |
| Engelse naam | 4-cyclohexyl-2-(2-cyclohexylethyl)-N-ethylbutanamide; |
| MF | C20H37NO |
| Molecuulgewicht | 307.5139 |
| InChI | InChI=1/C20H37NO/c1-2-21-20(22)19(15-13-17-9-5-3-6-10-17)16-14-18-11-7-4-8-12-18/h17-19H,2-16H2,1H3,(H,21,22) |
| CAS-nummer | 5437-89-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.926g/cm3 |
| Kookpunt | 463.3°C at 760 mmHg |
| Brekingsindex | 1.478 |
| Vlampunt | 286.6°C |
| Dampdruk | 9.21E-09mmHg at 25°C |
| MSDS | |