ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5784-09-8 4-(difenylmethyl)-N-[(1E)-(2,4,5-trimethoxyfenyl)methylideen]piperazine-1-amine |
|
| Naam product | 4-(difenylmethyl)-N-[(1E)-(2,4,5-trimethoxyfenyl)methylideen]piperazine-1-amine |
| Synoniemen | 1-Piperazinamine, 4-(difenylmethyl)-N-[(1E)-(2,4,5-trimethoxyfenyl)methyleen]-; 4-(difenylmethyl)-N-[(E)-(2,4,5-trimethoxyfenyl)methyleen]piperazine-1-amine; |
| Engelse naam | 4-(diphenylmethyl)-N-[(1E)-(2,4,5-trimethoxyphenyl)methylidene]piperazin-1-amine;1-Piperazinamine, 4-(diphenylmethyl)-N-[(1E)-(2,4,5-trimethoxyphenyl)methylene]-;4-(Diphenylmethyl)-N-[(E)-(2,4,5-trimethoxyphenyl)methylene]piperazin-1-amine |
| MF | C27H31N3O3 |
| Molecuulgewicht | 445.5533 |
| InChI | InChI=1/C27H31N3O3/c1-31-24-19-26(33-3)25(32-2)18-23(24)20-28-30-16-14-29(15-17-30)27(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,18-20,27H,14-17H2,1-3H3/b28-20+ |
| CAS-nummer | 5784-09-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.12g/cm3 |
| Kookpunt | 595.9°C at 760 mmHg |
| Brekingsindex | 1.577 |
| Vlampunt | 314.2°C |
| Dampdruk | 3.63E-14mmHg at 25°C |
| MSDS | |