ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57944-79-3 2-(1,3-dihydro-2H-isoindol-2-yl)ethanol |
|
| Naam product | 2-(1,3-dihydro-2H-isoindol-2-yl)ethanol |
| Synoniemen | 2H-isoindol-2-ethanol, 1,3-dihydro- |
| Engelse naam | 2-(1,3-dihydro-2H-isoindol-2-yl)ethanol;2H-isoindole-2-ethanol, 1,3-dihydro- |
| MF | C10H13NO |
| Molecuulgewicht | 163.2163 |
| InChI | InChI=1/C10H13NO/c12-6-5-11-7-9-3-1-2-4-10(9)8-11/h1-4,12H,5-8H2 |
| CAS-nummer | 57944-79-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.128g/cm3 |
| Kookpunt | 275.797°C at 760 mmHg |
| Brekingsindex | 1.581 |
| Vlampunt | 136.621°C |
| Dampdruk | 0.002mmHg at 25°C |
| MSDS | |