ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5845-48-7 (5E)-5-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylideen)-3-fenyl-1,3-thiazolidine-2,4-dion |
|
| Naam product | (5E)-5-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylideen)-3-fenyl-1,3-thiazolidine-2,4-dion |
| Engelse naam | (5E)-5-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-3-phenyl-1,3-thiazolidine-2,4-dione; |
| MF | C17H9N3O5S |
| Molecuulgewicht | 367.3355 |
| InChI | InChI=1/C17H9N3O5S/c21-15-13(11-8-10(20(24)25)6-7-12(11)18-15)14-16(22)19(17(23)26-14)9-4-2-1-3-5-9/h1-8H,(H,18,21)/b14-13+ |
| CAS-nummer | 5845-48-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.652g/cm3 |
| Brekingsindex | 1.763 |
| MSDS | |