ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 619-01-2 dihydrocarveol, mengsel van isomeren | |
| Naam product | dihydrocarveol, mengsel van isomeren | 
| Synoniemen | ;D ihydrocarveol, mengsel van isomeren; | 
| Engelse naam | dihydrocarveol, mixture of isomers;Dihydrocarveol,mixture of isomers | 
| MF | C10H18O | 
| Molecuulgewicht | 154.2493 | 
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3 | 
| CAS-nummer | 619-01-2 | 
| EINECS | 210-575-1 | 
| Moleculaire Structuur |  | 
| Kookpunt | 224℃ | 
| MSDS | |