ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
624-51-1 3-Nonanol |
|
Naam product | 3-Nonanol |
Engelse naam | 3-Nonanol;Ethyl n-hexyl carbinol;nonan-3-ol;(3R)-nonan-3-ol;(3S)-nonan-3-ol |
MF | C9H20O |
Molecuulgewicht | 144.2545 |
InChI | InChI=1/C9H20O/c1-3-5-6-7-8-9(10)4-2/h9-10H,3-8H2,1-2H3/t9-/m0/s1 |
CAS-nummer | 624-51-1 |
EINECS | 210-850-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.824g/cm3 |
Kookpunt | 196.6°C at 760 mmHg |
Brekingsindex | 1.43 |
Vlampunt | 79.5°C |
Dampdruk | 0.102mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |