ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6322-13-0 2-{[2-(4-chloorfenyl)-1-(4-methoxyfenyl)ethyl]amino}ethanol |
|
| Naam product | 2-{[2-(4-chloorfenyl)-1-(4-methoxyfenyl)ethyl]amino}ethanol |
| Synoniemen | ; |
| Engelse naam | 2-{[2-(4-chlorophenyl)-1-(4-methoxyphenyl)ethyl]amino}ethanol; |
| MF | C17H20ClNO2 |
| Molecuulgewicht | 305.7992 |
| InChI | InChI=1/C17H20ClNO2/c1-21-16-8-4-14(5-9-16)17(19-10-11-20)12-13-2-6-15(18)7-3-13/h2-9,17,19-20H,10-12H2,1H3 |
| CAS-nummer | 6322-13-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.18g/cm3 |
| Kookpunt | 453.5°C at 760 mmHg |
| Brekingsindex | 1.58 |
| Vlampunt | 228.1°C |
| Dampdruk | 5.15E-09mmHg at 25°C |
| MSDS | |