ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-35-6 2-chloro-4-fluoroacetophenone |
|
| Naam product | 2-chloro-4-fluoroacetophenone |
| Engelse naam | 2-chloro-4-fluoroacetophenone;2'-chloro-4'-fluoroacetophenone;1-(2-chloro-4-fluoro-phenyl)ethanone |
| MF | C8H6ClFO |
| Molecuulgewicht | 172.584 |
| InChI | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| CAS-nummer | 700-35-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.259g/cm3 |
| Kookpunt | 203.4°C at 760 mmHg |
| Brekingsindex | 1.512 |
| Vlampunt | 76.814°C |
| Dampdruk | 0.278mmHg at 25°C |
| Risico-codes | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |