ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72430-63-8 7-chloor-5-(4-methoxyfenyl)-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-on |
|
| Naam product | 7-chloor-5-(4-methoxyfenyl)-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-on |
| Synoniemen | 2H-1,4-benzodiazepine-2-on, 7-chloor-1,3-dihydro-5-(4-methoxyfenyl)-1-methyl-; |
| Engelse naam | 7-chloro-5-(4-methoxyphenyl)-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one;2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-5-(4-methoxyphenyl)-1-methyl- |
| MF | C17H15ClN2O2 |
| Molecuulgewicht | 314.7662 |
| InChI | InChI=1/C17H15ClN2O2/c1-20-15-8-5-12(18)9-14(15)17(19-10-16(20)21)11-3-6-13(22-2)7-4-11/h3-9H,10H2,1-2H3 |
| CAS-nummer | 72430-63-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.27g/cm3 |
| Kookpunt | 525.2°C at 760 mmHg |
| Brekingsindex | 1.617 |
| Vlampunt | 271.4°C |
| Dampdruk | 4.02E-11mmHg at 25°C |
| MSDS | |