ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73606-98-1 1,10,11-trihydroxy-8-methyl-4-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]-5,11-dihydro-6H-dibenzo[b,e]azepin-6-on |
|
| Naam product | 1,10,11-trihydroxy-8-methyl-4-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]-5,11-dihydro-6H-dibenzo[b,e]azepin-6-on |
| Synoniemen | ; |
| Engelse naam | 1,10,11-trihydroxy-8-methyl-4-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]-5,11-dihydro-6H-dibenzo[b,e]azepin-6-one; |
| MF | C25H29NO5 |
| Molecuulgewicht | 423.5015 |
| InChI | InChI=1/C25H29NO5/c1-13(2)6-7-16-8-9-17(27)20-22(16)26-25(30)21-19(23(20)29)18(28)12-15(5)24(21)31-11-10-14(3)4/h6,8-10,12,23,27-29H,7,11H2,1-5H3,(H,26,30) |
| CAS-nummer | 73606-98-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.225g/cm3 |
| Kookpunt | 564.9°C at 760 mmHg |
| Brekingsindex | 1.614 |
| Vlampunt | 295.4°C |
| Dampdruk | 2.3E-13mmHg at 25°C |
| MSDS | |