ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73746-44-8 4,5-diiodo-2-methyl-1H-imidazole |
|
Naam product | 4,5-diiodo-2-methyl-1H-imidazole |
Engelse naam | 4,5-diiodo-2-methyl-1H-imidazole;4,5-Diiodo-2-methylimidazole |
MF | C4H4I2N2 |
Molecuulgewicht | 333.8969 |
InChI | InChI=1/C4H4I2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
CAS-nummer | 73746-44-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 2.75g/cm3 |
Smeltpunt | 194℃ |
Kookpunt | 434.9°C at 760 mmHg |
Brekingsindex | 1.749 |
Vlampunt | 216.8°C |
Dampdruk | 2.33E-07mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |