ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74101-58-9 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one |
|
| Naam product | 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one |
| Engelse naam | 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one;4(3H)-Quinazolinone, 7-chloro-3-(3,5-dimethylphenyl)-2-methyl- |
| MF | C17H15ClN2O |
| Molecuulgewicht | 298.7668 |
| InChI | InChI=1/C17H15ClN2O/c1-10-6-11(2)8-14(7-10)20-12(3)19-16-9-13(18)4-5-15(16)17(20)21/h4-9H,1-3H3 |
| CAS-nummer | 74101-58-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.24g/cm3 |
| Kookpunt | 475.2°C at 760 mmHg |
| Brekingsindex | 1.627 |
| Vlampunt | 241.2°C |
| Dampdruk | 3.38E-09mmHg at 25°C |
| MSDS | |