ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74641-30-8 1,2-bis(4-chlorophenyl)ethane-1,2-diamine |
|
| Naam product | 1,2-bis(4-chlorophenyl)ethane-1,2-diamine |
| Engelse naam | 1,2-bis(4-chlorophenyl)ethane-1,2-diamine;1,2-Bis(4-chlorophenyl)-1,2-ethanediamine;1,2-ethanediamine, 1,2-bis(4-chlorophenyl)-;(1R,2S)-1,2-bis(4-chlorophenyl)ethane-1,2-diaminium |
| MF | C14H16Cl2N2 |
| Molecuulgewicht | 283.1951 |
| InChI | InChI=1/C14H14Cl2N2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H,17-18H2/p+2/t13-,14+ |
| CAS-nummer | 74641-30-8;86212-34-2;98674-96-5 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 418.574°C at 760 mmHg |
| Vlampunt | 206.946°C |
| Dampdruk | 0mmHg at 25°C |
| MSDS | |