ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1098-29-9 1-[(E)-1-broom-2-(4-methoxyfenyl)-2-fenylethenyl]-2-fluorobenzeen |
|
| Naam product | 1-[(E)-1-broom-2-(4-methoxyfenyl)-2-fenylethenyl]-2-fluorobenzeen |
| Engelse naam | 1-[(E)-1-bromo-2-(4-methoxyphenyl)-2-phenylethenyl]-2-fluorobenzene; |
| MF | C21H16BrFO |
| Molecuulgewicht | 383.2535 |
| InChI | InChI=1/C21H16BrFO/c1-24-17-13-11-16(12-14-17)20(15-7-3-2-4-8-15)21(22)18-9-5-6-10-19(18)23/h2-14H,1H3/b21-20+ |
| CAS-nummer | 1098-29-9;800-31-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.35g/cm3 |
| Kookpunt | 443.4°C at 760 mmHg |
| Brekingsindex | 1.62 |
| Vlampunt | 268.7°C |
| Dampdruk | 1.22E-07mmHg at 25°C |
| MSDS | |