ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-68-6 Acryloyl chloride |
|
Naam product | Acryloyl chloride |
Engelse naam | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
MF | C3H3OCl |
Molecuulgewicht | 90.5083 |
InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
CAS-nummer | 814-68-6 |
EINECS | 212-399-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.108g/cm3 |
Kookpunt | 75.5°C at 760 mmHg |
Brekingsindex | 1.417 |
Vlampunt | 16.1°C |
Dampdruk | 105mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R11##Highly flammable.||R34##Causes burns.:; |
Veiligheid Omschrijving | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |