ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-22-4 1,1'-dianthrimide |
|
| Naam product | 1,1'-dianthrimide |
| Synoniemen | 1,1-iminodianthrachinon; 1,1'-iminodianthraceen-9,10-dion; |
| Engelse naam | 1,1'-dianthrimide;1,1-iminodianthraquinone;1,1'-iminodianthracene-9,10-dione |
| MF | C28H15NO4 |
| Molecuulgewicht | 429.423 |
| InChI | InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
| CAS-nummer | 82-22-4 |
| EINECS | 201-405-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.456g/cm3 |
| Smeltpunt | 300℃ |
| Kookpunt | 667.1°C at 760 mmHg |
| Brekingsindex | 1.753 |
| Vlampunt | 221.6°C |
| Dampdruk | 1.17E-17mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |