ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture |
|
| Naam product | 2-hydroxyimino-2-phenylacetonitrile, mixture |
| Engelse naam | 2-hydroxyimino-2-phenylacetonitrile, mixture;2-Hydroxyimino-2-phenylacetonitrile;Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime;(hydroxyimino)(phenyl)acetonitrile;(2E)-(hydroxyimino)(phenyl)ethanenitrile |
| MF | C8H6N2O |
| Molecuulgewicht | 146.146 |
| InChI | InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
| CAS-nummer | 825-52-5 |
| EINECS | 212-546-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.11g/cm3 |
| Smeltpunt | 128-130℃ |
| Kookpunt | 293.3°C at 760 mmHg |
| Brekingsindex | 1.562 |
| Vlampunt | 131.2°C |
| Dampdruk | 0.000793mmHg at 25°C |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |