ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84418-43-9 9-fluorenylmethyl carbamate |
|
| Naam product | 9-fluorenylmethyl carbamate |
| Engelse naam | 9-fluorenylmethyl carbamate;Fmoc-NH2;9H-fluoren-9-ylmethyl carbamate |
| MF | C15H13NO2 |
| Molecuulgewicht | 239.2692 |
| InChI | InChI=1/C15H13NO2/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H2,16,17) |
| CAS-nummer | 84418-43-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.239g/cm3 |
| Smeltpunt | 201-204℃ |
| Kookpunt | 459.7°C at 760 mmHg |
| Brekingsindex | 1.627 |
| Vlampunt | 242.3°C |
| Dampdruk | 1.24E-08mmHg at 25°C |
| Veiligheid Omschrijving | S22||S24/25:; |
| MSDS | |