ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
855-97-0 3',4',5,7-Tetramethoxyflavone |
|
| Naam product | 3',4',5,7-Tetramethoxyflavone |
| Engelse naam | 3',4',5,7-Tetramethoxyflavone;Luteolin tetramethyl ether;2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
| MF | C19H18O6 |
| Molecuulgewicht | 342.3426 |
| InChI | InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| CAS-nummer | 855-97-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.243g/cm3 |
| Kookpunt | 528.8°C at 760 mmHg |
| Brekingsindex | 1.574 |
| Vlampunt | 233.9°C |
| Dampdruk | 2.86E-11mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |