ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-68-6 Anthranilamide |
|
| Naam product | Anthranilamide |
| Engelse naam | Anthranilamide;2-Aminobenzamide, (Anthranilamide);ATA;Anthranilic acid amide;2-Aminobenzamide;O-Aminobenzamide |
| MF | C7H8N2O |
| Molecuulgewicht | 136.1512 |
| InChI | InChI=1/C7H8N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H2,9,10) |
| CAS-nummer | 88-68-6 |
| EINECS | 201-851-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.233g/cm3 |
| Smeltpunt | 111-114℃ |
| Kookpunt | 300.898°C at 760 mmHg |
| Brekingsindex | 1.633 |
| Vlampunt | 135.778°C |
| Dampdruk | 0.001mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R22||R36/37/38||R43:; |
| Veiligheid Omschrijving | S26||S36/37:; |
| MSDS | |