ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91692-67-0 3,5-dibroom-N-(4-broomfenyl)-4-hydroxybenzamide |
|
| Naam product | 3,5-dibroom-N-(4-broomfenyl)-4-hydroxybenzamide |
| Engelse naam | 3,5-dibromo-N-(4-bromophenyl)-4-hydroxybenzamide; |
| MF | C13H8Br3NO2 |
| Molecuulgewicht | 449.9201 |
| InChI | InChI=1/C13H8Br3NO2/c14-8-1-3-9(4-2-8)17-13(19)7-5-10(15)12(18)11(16)6-7/h1-6,18H,(H,17,19) |
| CAS-nummer | 91692-67-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 2.089g/cm3 |
| Kookpunt | 405.7°C at 760 mmHg |
| Brekingsindex | 1.728 |
| Vlampunt | 199.2°C |
| Dampdruk | 3.65E-07mmHg at 25°C |
| MSDS | |