ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
973-67-1 5,6,7-Trimethoxyflavone |
|
Naam product | 5,6,7-Trimethoxyflavone |
Engelse naam | 5,6,7-Trimethoxyflavone;Baicalein trimethyl ether;5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
MF | C18H16O5 |
Molecuulgewicht | 312.3166 |
InChI | InChI=1/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
CAS-nummer | 973-67-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.242g/cm3 |
Smeltpunt | 165-167℃ |
Kookpunt | 497.4°C at 760 mmHg |
Brekingsindex | 1.585 |
Vlampunt | 221.3°C |
Dampdruk | 4.97E-10mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |