ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1444-65-1 2-Phenylcyclohexanone |
|
produktnavn | 2-Phenylcyclohexanone |
Engelsk navn | 2-Phenylcyclohexanone;AI3-07036;Cyclohexanone, 2-phenyl-;(2S)-2-phenylcyclohexanone;(2R)-2-phenylcyclohexanone |
Molekylær Formel | C12H14O |
Molekylvekt | 174.239 |
InChI | InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
CAS-nummer | 1444-65-1 |
EINECS | 215-888-7 |
Molecular Structure | ![]() |
Tetthet | 1.042g/cm3 |
Smeltepunkt | 56-59℃ |
Kokepunkt | 294°C at 760 mmHg |
Brytningsindeks | 1.537 |
Flammepunktet | 123.7°C |
Damptrykk | 0.00167mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |