ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
161446-90-8 3-Chloro-4-fluorobenzyl alcohol |
|
produktnavn | 3-Chloro-4-fluorobenzyl alcohol |
Engelsk navn | 3-Chloro-4-fluorobenzyl alcohol;(3-chloro-4-fluorophenyl)methanol;3-Chloro-4-fluorobenzyla alcohol |
Molekylær Formel | C7H6ClFO |
Molekylvekt | 160.5733 |
InChI | InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
CAS-nummer | 161446-90-8 |
Molecular Structure | ![]() |
Tetthet | 1.344g/cm3 |
Kokepunkt | 242.5°C at 760 mmHg |
Brytningsindeks | 1.542 |
Flammepunktet | 100.4°C |
Damptrykk | 0.0183mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |