Chemindex > 17969-22-1
NO ▼
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
|
| produktnavn | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| Engelsk navn | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
| Molekylær Formel | C10H7Cl2NS |
| Molekylvekt | 244.1403 |
| InChI | InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| CAS-nummer | 17969-22-1 |
| Molecular Structure |  |
| Tetthet | 1.378g/cm3 |
| Smeltepunkt | 78℃ |
| Kokepunkt | 374°C at 760 mmHg |
| Brytningsindeks | 1.617 |
| Flammepunktet | 180°C |
| Damptrykk | 1.85E-05mmHg at 25°C |
| Hazard symboler |  C##Corrosive:; |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 